Products 2325666-14-4
CAS 2325666-14-4 is the registry number for 1-(4-Chlorothieno[3,2-d]pyrimidin-6-yl)propan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-chlorothieno[3,2-d]pyrimidin-6-yl)propan-1-ol (CAS 2325666-14-4) is a chemical compound with the molecular formula C9H9ClN2OS and a molecular weight of 228.70 g/mol. IUPAC name: 1-(4-chlorothieno[3,2-d]pyrimidin-6-yl)propan-1-ol. InChIKey: AQLXZSMPVUZDOP-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2OS |
|---|---|
| Molecular weight | 228.70 g/mol |
| IUPAC name | 1-(4-chlorothieno[3,2-d]pyrimidin-6-yl)propan-1-ol |
| InChIKey | AQLXZSMPVUZDOP-UHFFFAOYSA-N |
| SMILES | CCC(C1=CC2=C(S1)C(=NC=N2)Cl)O |
Computed by PubChem (NCBI)