CAS 91225-68-2 appears in our catalog under these names: 2-(Chloromethyl)-6-ethylthieno(2,3-d)pyrimidin-4(3H)-one, 97%, 2-Chloromethyl-6-ethyl-3H-thieno(2,3-d)pyrimidin-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 50mg, 0,5g.
2-(chloromethyl)-6-ethyl-3H-thieno[2,3-d]pyrimidin-4-one (CAS 91225-68-2) is a chemical compound with the molecular formula C9H9ClN2OS and a molecular weight of 228.70 g/mol. IUPAC name: 2-(chloromethyl)-6-ethyl-3H-thieno[2,3-d]pyrimidin-4-one. InChIKey: HQBIRTSAZOYXAK-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2OS |
|---|---|
| Molecular weight | 228.70 g/mol |
| IUPAC name | 2-(chloromethyl)-6-ethyl-3H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | HQBIRTSAZOYXAK-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(S1)N=C(NC2=O)CCl |
Computed by PubChem (NCBI)