CAS 19580-45-1 appears in our catalog under these names: 5-(3-Chloropropyl)-3-thien-2-yl-1,2,4-oxadiazole, 95%, 5-(3-Chloropropyl)-3-(thiophen-2-yl)-1,2,4-oxadiazole, 95%, 5-(3-Chloropropyl)-3-(thiophen-2-yl)-1,2,4-oxadiazole. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
5-(3-chloropropyl)-3-thiophen-2-yl-1,2,4-oxadiazole (CAS 19580-45-1) is a chemical compound with the molecular formula C9H9ClN2OS and a molecular weight of 228.70 g/mol. IUPAC name: 5-(3-chloropropyl)-3-thiophen-2-yl-1,2,4-oxadiazole. InChIKey: QOPNCXIRVQGVFL-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2OS |
|---|---|
| Molecular weight | 228.70 g/mol |
| IUPAC name | 5-(3-chloropropyl)-3-thiophen-2-yl-1,2,4-oxadiazole |
| InChIKey | QOPNCXIRVQGVFL-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=NOC(=N2)CCCCl |
Computed by PubChem (NCBI)