CAS 14151-65-6 is the registry number for 3,5-Dichlorobisphenol A, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg.
2,6-dichloro-4-[2-(4-hydroxyphenyl)propan-2-yl]phenol (CAS 14151-65-6) is a chemical compound with the molecular formula C15H14Cl2O2 and a molecular weight of 297.2 g/mol. IUPAC name: 2,6-dichloro-4-[2-(4-hydroxyphenyl)propan-2-yl]phenol. InChIKey: ZUPWAEAGAFKCJG-UHFFFAOYSA-N.
| Molecular formula | C15H14Cl2O2 |
|---|---|
| Molecular weight | 297.2 g/mol |
| IUPAC name | 2,6-dichloro-4-[2-(4-hydroxyphenyl)propan-2-yl]phenol |
| InChIKey | ZUPWAEAGAFKCJG-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)O)C2=CC(=C(C(=C2)Cl)O)Cl |
Computed by PubChem (NCBI)