CAS 79-98-1 appears in our catalog under these names: 3,3'-Dichlorobisphenol A, 98%, 98%, 4,4'-(Propane-2,2-diyl)bis(2-chlorophenol), 98%, 3,3'-Dichlorobisphenol A, >95% (HPLC), 3,3'-Dichlorobisphenol A. Offered by: Chemat, Chemat Brand, TRC, Biosynth, Fluorochem. Available pack sizes: 250mg, 100mg, on request, 1mg, 25mg, 5mg, 2mg.
2-chloro-4-[2-(3-chloro-4-hydroxyphenyl)propan-2-yl]phenol (CAS 79-98-1) is a chemical compound with the molecular formula C15H14Cl2O2 and a molecular weight of 297.2 g/mol. IUPAC name: 2-chloro-4-[2-(3-chloro-4-hydroxyphenyl)propan-2-yl]phenol. InChIKey: XBQRPFBBTWXIFI-UHFFFAOYSA-N.
| Molecular formula | C15H14Cl2O2 |
|---|---|
| Molecular weight | 297.2 g/mol |
| IUPAC name | 2-chloro-4-[2-(3-chloro-4-hydroxyphenyl)propan-2-yl]phenol |
| InChIKey | XBQRPFBBTWXIFI-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=C(C=C1)O)Cl)C2=CC(=C(C=C2)O)Cl |
Computed by PubChem (NCBI)