CAS 1956322-92-1 is the registry number for 2,4-Dichloro-1-(((4-methoxybenzyl)oxy)methyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.
2,4-dichloro-1-[(4-methoxyphenyl)methoxymethyl]benzene (CAS 1956322-92-1) is a chemical compound with the molecular formula C15H14Cl2O2 and a molecular weight of 297.2 g/mol. IUPAC name: 2,4-dichloro-1-[(4-methoxyphenyl)methoxymethyl]benzene. InChIKey: SPKAHIFUKDSNQY-UHFFFAOYSA-N.
| Molecular formula | C15H14Cl2O2 |
|---|---|
| Molecular weight | 297.2 g/mol |
| IUPAC name | 2,4-dichloro-1-[(4-methoxyphenyl)methoxymethyl]benzene |
| InChIKey | SPKAHIFUKDSNQY-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)COCC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)