CAS 188928-11-2 is the registry number for 2-(4-(3,4-Dichlorobenzyloxy)phenylethanol. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
2-[4-[(3,4-dichlorophenyl)methoxy]phenyl]ethanol (CAS 188928-11-2) is a chemical compound with the molecular formula C15H14Cl2O2 and a molecular weight of 297.2 g/mol. IUPAC name: 2-[4-[(3,4-dichlorophenyl)methoxy]phenyl]ethanol. InChIKey: ODXXRJUWIQJJJX-UHFFFAOYSA-N.
| Molecular formula | C15H14Cl2O2 |
|---|---|
| Molecular weight | 297.2 g/mol |
| IUPAC name | 2-[4-[(3,4-dichlorophenyl)methoxy]phenyl]ethanol |
| InChIKey | ODXXRJUWIQJJJX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCO)OCC2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)