CAS 141511-42-4 appears in our catalog under these names: 2,5-Di(pyridin-4-yl)thiophene 95%, 2,5-Di(pyridin-4-yl)thiophene, 95%, 2,5-Di(pyridin-4-yl)thiophene, 95%, 95%. Offered by: Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-(5-pyridin-4-ylthiophen-2-yl)pyridine (CAS 141511-42-4) is a chemical compound with the molecular formula C14H10N2S and a molecular weight of 238.31 g/mol. IUPAC name: 4-(5-pyridin-4-ylthiophen-2-yl)pyridine. InChIKey: YLQPWBWBAUMDEE-UHFFFAOYSA-N.
| Molecular formula | C14H10N2S |
|---|---|
| Molecular weight | 238.31 g/mol |
| IUPAC name | 4-(5-pyridin-4-ylthiophen-2-yl)pyridine |
| InChIKey | YLQPWBWBAUMDEE-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=CC=C(S2)C3=CC=NC=C3 |
Computed by PubChem (NCBI)