CAS 832740-99-5 appears in our catalog under these names: 4-(2-Naphthyl)pyrimidine-2(1h)-thione, 95%, 4-Naphthalen-2-yl-pyrimidine-2-thiol. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
6-naphthalen-2-yl-1H-pyrimidine-2-thione (CAS 832740-99-5) is a chemical compound with the molecular formula C14H10N2S and a molecular weight of 238.31 g/mol. IUPAC name: 6-naphthalen-2-yl-1H-pyrimidine-2-thione. InChIKey: LGLGIYOFLYYPPA-UHFFFAOYSA-N.
| Molecular formula | C14H10N2S |
|---|---|
| Molecular weight | 238.31 g/mol |
| IUPAC name | 6-naphthalen-2-yl-1H-pyrimidine-2-thione |
| InChIKey | LGLGIYOFLYYPPA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C3=CC=NC(=S)N3 |
Computed by PubChem (NCBI)