CAS 210363-85-2 is the registry number for 4–(2–Thienyl)–2,2‘–bipyridine. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
2-pyridin-2-yl-4-thiophen-2-ylpyridine (CAS 210363-85-2) is a chemical compound with the molecular formula C14H10N2S and a molecular weight of 238.31 g/mol. IUPAC name: 2-pyridin-2-yl-4-thiophen-2-ylpyridine. InChIKey: SLGDHXJAMVNOMJ-UHFFFAOYSA-N.
| Molecular formula | C14H10N2S |
|---|---|
| Molecular weight | 238.31 g/mol |
| IUPAC name | 2-pyridin-2-yl-4-thiophen-2-ylpyridine |
| InChIKey | SLGDHXJAMVNOMJ-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=NC=CC(=C2)C3=CC=CS3 |
Computed by PubChem (NCBI)