Products 5393-99-7
CAS 5393-99-7 is the registry number for 4,5-Diphenyl-1,2,3-thiadiazole, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
4,5-diphenylthiadiazole (CAS 5393-99-7) is a chemical compound with the molecular formula C14H10N2S and a molecular weight of 238.31 g/mol. IUPAC name: 4,5-diphenylthiadiazole. InChIKey: QVGVWLHVMVQIQI-UHFFFAOYSA-N.
| Molecular formula | C14H10N2S |
|---|---|
| Molecular weight | 238.31 g/mol |
| IUPAC name | 4,5-diphenylthiadiazole |
| InChIKey | QVGVWLHVMVQIQI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(SN=N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
4,5-Diphenyl-1,2,3-thiadiazole, 4,5-diphenylthiadiazole, 4,5-Diphenyl-[1,2,3]thiadiazole, 1,2,3-Thiadiazole, 4,5-diphenyl-, 4,2,3-thiadiazole, Maybridge1_007621, 4,5-Diphenyl-1,2,3-thiadiazol, 1,3-Thiadiazole, 4,5-diphenyl-, 4,5-di-phenyl-1,2,3-thiadiazole, 4,5-Diphenyl-1,2,3-thiadiazole, AldrichCPR