Products 1415257-41-8
CAS 1415257-41-8 appears in our catalog under these names: (S)–1–(4–Isopropoxyphenyl)ethan–1–amine hydrochloride, (S)-1-(4-Isopropoxyphenyl)ethan-1-amine hydrochloride, 97%, 97%, (S)-1-(4-Isopropoxyphenyl)ethan-1-amine hydrochloride, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
(1S)-1-(4-propan-2-yloxyphenyl)ethanamine;hydrochloride (CAS 1415257-41-8) is a chemical compound with the molecular formula C11H18ClNO and a molecular weight of 215.72 g/mol. IUPAC name: (1S)-1-(4-propan-2-yloxyphenyl)ethanamine;hydrochloride. InChIKey: ZFAXPIYAUOLSGN-FVGYRXGTSA-N.
| Molecular formula | C11H18ClNO |
|---|---|
| Molecular weight | 215.72 g/mol |
| IUPAC name | (1S)-1-(4-propan-2-yloxyphenyl)ethanamine;hydrochloride |
| InChIKey | ZFAXPIYAUOLSGN-FVGYRXGTSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)OC(C)C)N.Cl |
Computed by PubChem (NCBI)