CAS 1415473-87-8 is the registry number for N-(2-(3,4-Dichlorobenzoyl)phenyl)acetamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
N-[2-(3,4-dichlorobenzoyl)phenyl]acetamide (CAS 1415473-87-8) is a chemical compound with the molecular formula C15H11Cl2NO2 and a molecular weight of 308.2 g/mol. IUPAC name: N-[2-(3,4-dichlorobenzoyl)phenyl]acetamide. InChIKey: MSYSBEFSEDKVPG-UHFFFAOYSA-N.
| Molecular formula | C15H11Cl2NO2 |
|---|---|
| Molecular weight | 308.2 g/mol |
| IUPAC name | N-[2-(3,4-dichlorobenzoyl)phenyl]acetamide |
| InChIKey | MSYSBEFSEDKVPG-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=CC=C1C(=O)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)