CAS 4016-85-7 appears in our catalog under these names: 2'-Benzoyl-2,4'-dichloroacetanilide, 95%, Alprazolam Impurity 1, 2'-Benzoyl-2,4'-dichloroacetanilide, >95% (HPLC), 2'-Benzoyl-2,4'-dichloroacetanilide, N-(2-Benzoyl-4-chlorophenyl)-2-chloroacetamide 95%. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, Ambeed. Available pack sizes: 1g, 5g, on request, 2,5g, 250mg, 2g, 25mg, 100mg.
N-(2-benzoyl-4-chlorophenyl)-2-chloroacetamide (CAS 4016-85-7) is a chemical compound with the molecular formula C15H11Cl2NO2 and a molecular weight of 308.2 g/mol. IUPAC name: N-(2-benzoyl-4-chlorophenyl)-2-chloroacetamide. InChIKey: HDXLZRWEZZFDKA-UHFFFAOYSA-N.
| Molecular formula | C15H11Cl2NO2 |
|---|---|
| Molecular weight | 308.2 g/mol |
| IUPAC name | N-(2-benzoyl-4-chlorophenyl)-2-chloroacetamide |
| InChIKey | HDXLZRWEZZFDKA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(C=CC(=C2)Cl)NC(=O)CCl |
Computed by PubChem (NCBI)