CAS 300816-42-6 appears in our catalog under these names: 3-(3,6-Dichloro-9H-carbazol-9-yl)propanoic acid, 98%, 3-(3,6-dichloro-9H-carbazol-9-yl)propanoic acid/ 97.85% (existing batch purity), 3-(3,6-Dichloro-9H-carbazol-9-yl)propanoic acid, ML67, 3-(3,6-Dichloro-9h-carbazol-9-yl)propanoic acid, 95%. Offered by: AmBeed, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1g.
3-(3,6-dichlorocarbazol-9-yl)propanoic acid (CAS 300816-42-6) is a chemical compound with the molecular formula C15H11Cl2NO2 and a molecular weight of 308.2 g/mol. IUPAC name: 3-(3,6-dichlorocarbazol-9-yl)propanoic acid. InChIKey: KDYNAXRKXFKHLN-UHFFFAOYSA-N.
| Molecular formula | C15H11Cl2NO2 |
|---|---|
| Molecular weight | 308.2 g/mol |
| IUPAC name | 3-(3,6-dichlorocarbazol-9-yl)propanoic acid |
| InChIKey | KDYNAXRKXFKHLN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C3=C(N2CCC(=O)O)C=CC(=C3)Cl |
Computed by PubChem (NCBI)