CAS 316143-07-4 appears in our catalog under these names: N-(3-Acetylphenyl)-2,4-dichlorobenzamide, 95%, N-(3-Acetylphenyl)-2,4-dichlorobenzamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
N-(3-acetylphenyl)-2,4-dichlorobenzamide (CAS 316143-07-4) is a chemical compound with the molecular formula C15H11Cl2NO2 and a molecular weight of 308.2 g/mol. IUPAC name: N-(3-acetylphenyl)-2,4-dichlorobenzamide. InChIKey: WYENSOXGXSFVCY-UHFFFAOYSA-N.
| Molecular formula | C15H11Cl2NO2 |
|---|---|
| Molecular weight | 308.2 g/mol |
| IUPAC name | N-(3-acetylphenyl)-2,4-dichlorobenzamide |
| InChIKey | WYENSOXGXSFVCY-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)NC(=O)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)