CAS 1415562-36-5 appears in our catalog under these names: 2,3-Bis(4-chlorophenyl)butane-2,3-diamine, 97%, 2,3-Bis(4-chlorophenyl)butane-2,3-diamine, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
2,3-bis(4-chlorophenyl)butane-2,3-diamine (CAS 1415562-36-5) is a chemical compound with the molecular formula C16H18Cl2N2 and a molecular weight of 309.2 g/mol. IUPAC name: 2,3-bis(4-chlorophenyl)butane-2,3-diamine. InChIKey: LWRJAHOWKXOLSQ-UHFFFAOYSA-N.
| Molecular formula | C16H18Cl2N2 |
|---|---|
| Molecular weight | 309.2 g/mol |
| IUPAC name | 2,3-bis(4-chlorophenyl)butane-2,3-diamine |
| InChIKey | LWRJAHOWKXOLSQ-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)Cl)(C(C)(C2=CC=C(C=C2)Cl)N)N |
Computed by PubChem (NCBI)