Products 2444430-73-1
CAS 2444430-73-1 appears in our catalog under these names: (1R,2R)-1,2-Bis(2-chlorophenyl)-N1,N2-dimethylethane-1,2-diamine, 98%, 98%, (1R,2R)-1,2-Bis(2-chlorophenyl)-N1,N2-dimethylethane-1,2-diamine, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(1R,2R)-1,2-bis(2-chlorophenyl)-N,N'-dimethylethane-1,2-diamine (CAS 2444430-73-1) is a chemical compound with the molecular formula C16H18Cl2N2 and a molecular weight of 309.2 g/mol. IUPAC name: (1R,2R)-1,2-bis(2-chlorophenyl)-N,N'-dimethylethane-1,2-diamine. InChIKey: OVKICWHBCIYOJE-HZPDHXFCSA-N.
| Molecular formula | C16H18Cl2N2 |
|---|---|
| Molecular weight | 309.2 g/mol |
| IUPAC name | (1R,2R)-1,2-bis(2-chlorophenyl)-N,N'-dimethylethane-1,2-diamine |
| InChIKey | OVKICWHBCIYOJE-HZPDHXFCSA-N |
| SMILES | CN[C@H](C1=CC=CC=C1Cl)[C@@H](C2=CC=CC=C2Cl)NC |
Computed by PubChem (NCBI)