CAS 939983-16-1 appears in our catalog under these names: (2R,3S)-Rel-2,3-bis(4-chlorophenyl)butane-2,3-diamine, 95%, (2R,3S)-rel-2,3-Bis(4-chlorophenyl)butane-2,3-diamine, 98%, 98%, (2R,3S)-rel-2,3-Bis(4-chlorophenyl)butane-2,3-diamine, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
(2R,3S)-2,3-bis(4-chlorophenyl)butane-2,3-diamine (CAS 939983-16-1) is a chemical compound with the molecular formula C16H18Cl2N2 and a molecular weight of 309.2 g/mol. IUPAC name: (2R,3S)-2,3-bis(4-chlorophenyl)butane-2,3-diamine. InChIKey: LWRJAHOWKXOLSQ-IYBDPMFKSA-N.
| Molecular formula | C16H18Cl2N2 |
|---|---|
| Molecular weight | 309.2 g/mol |
| IUPAC name | (2R,3S)-2,3-bis(4-chlorophenyl)butane-2,3-diamine |
| InChIKey | LWRJAHOWKXOLSQ-IYBDPMFKSA-N |
| SMILES | C[C@@](C1=CC=C(C=C1)Cl)([C@](C)(C2=CC=C(C=C2)Cl)N)N |
Computed by PubChem (NCBI)