CAS 1429231-94-6 is the registry number for (2R,3S)-2,3-Bis(4-chlorophenyl)butane-2,3-diamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3S)-2,3-bis(4-chlorophenyl)butane-2,3-diamine (CAS 1429231-94-6) is a chemical compound with the molecular formula C16H18Cl2N2 and a molecular weight of 309.2 g/mol. IUPAC name: (2R,3S)-2,3-bis(4-chlorophenyl)butane-2,3-diamine. InChIKey: LWRJAHOWKXOLSQ-IYBDPMFKSA-N.
| Molecular formula | C16H18Cl2N2 |
|---|---|
| Molecular weight | 309.2 g/mol |
| IUPAC name | (2R,3S)-2,3-bis(4-chlorophenyl)butane-2,3-diamine |
| InChIKey | LWRJAHOWKXOLSQ-IYBDPMFKSA-N |
| SMILES | C[C@@](C1=CC=C(C=C1)Cl)([C@](C)(C2=CC=C(C=C2)Cl)N)N |
Computed by PubChem (NCBI)