Products 141557-41-7

CAS 141557-41-7 is the registry number for Methyl 3-((dimethylcarbamoyl)sulfanyl)thiophene-2-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 3-(dimethylcarbamoylsulfanyl)thiophene-2-carboxylate (CAS 141557-41-7) is a chemical compound with the molecular formula C9H11NO3S2 and a molecular weight of 245.3 g/mol. IUPAC name: methyl 3-(dimethylcarbamoylsulfanyl)thiophene-2-carboxylate. InChIKey: FKIOSCMUMOQGQX-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11NO3S2
Molecular weight245.3 g/mol
IUPAC namemethyl 3-(dimethylcarbamoylsulfanyl)thiophene-2-carboxylate
InChIKeyFKIOSCMUMOQGQX-UHFFFAOYSA-N
SMILESCN(C)C(=O)SC1=C(SC=C1)C(=O)OC

Computed by PubChem (NCBI)