CAS 175202-79-6 is the registry number for 1,5,6-Trimethyl-1H-thieno[2,3-c][1,2]thiazin-4(3H)-one 2,2-dioxide, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
1,5,6-trimethyl-2,2-dioxothieno[2,3-c]thiazin-4-one (CAS 175202-79-6) is a chemical compound with the molecular formula C9H11NO3S2 and a molecular weight of 245.3 g/mol. IUPAC name: 1,5,6-trimethyl-2,2-dioxothieno[2,3-c]thiazin-4-one. InChIKey: LXRNFMSHWRSCAY-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3S2 |
|---|---|
| Molecular weight | 245.3 g/mol |
| IUPAC name | 1,5,6-trimethyl-2,2-dioxothieno[2,3-c]thiazin-4-one |
| InChIKey | LXRNFMSHWRSCAY-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=O)CS(=O)(=O)N2C)C |
Computed by PubChem (NCBI)