CAS 216983-37-8 is the registry number for 1-(Thiophene-2-sulfonyl)piperidin-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.
1-thiophen-2-ylsulfonylpiperidin-4-one (CAS 216983-37-8) is a chemical compound with the molecular formula C9H11NO3S2 and a molecular weight of 245.3 g/mol. IUPAC name: 1-thiophen-2-ylsulfonylpiperidin-4-one. InChIKey: MVZWGORBAVDWHT-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3S2 |
|---|---|
| Molecular weight | 245.3 g/mol |
| IUPAC name | 1-thiophen-2-ylsulfonylpiperidin-4-one |
| InChIKey | MVZWGORBAVDWHT-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1=O)S(=O)(=O)C2=CC=CS2 |
Computed by PubChem (NCBI)