CAS 374098-76-7 is the registry number for N-(1,1-Dioxidotetrahydrothiophen-3-yl)thiophene-2-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(1,1-dioxothiolan-3-yl)thiophene-2-carboxamide (CAS 374098-76-7) is a chemical compound with the molecular formula C9H11NO3S2 and a molecular weight of 245.3 g/mol. IUPAC name: N-(1,1-dioxothiolan-3-yl)thiophene-2-carboxamide. InChIKey: QZITWTJGIMOGOA-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3S2 |
|---|---|
| Molecular weight | 245.3 g/mol |
| IUPAC name | N-(1,1-dioxothiolan-3-yl)thiophene-2-carboxamide |
| InChIKey | QZITWTJGIMOGOA-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1NC(=O)C2=CC=CS2 |
Computed by PubChem (NCBI)