Products 1415719-25-3
CAS 1415719-25-3 appears in our catalog under these names: 3-(5,5-Dimethyl-2,4-dioxoimidazolidin-1-yl)propanoic acid, 95%, 3-(5,5-Dimethyl-2,4-dioxoimidazolidin-1-yl)propanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
3-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)propanoic acid (CAS 1415719-25-3) is a chemical compound with the molecular formula C8H12N2O4 and a molecular weight of 200.19 g/mol. IUPAC name: 3-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)propanoic acid. InChIKey: VQOFRZLXGKPBFA-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O4 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | 3-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)propanoic acid |
| InChIKey | VQOFRZLXGKPBFA-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC(=O)N1CCC(=O)O)C |
Computed by PubChem (NCBI)