Products 2227198-66-3
CAS 2227198-66-3 appears in our catalog under these names: (3R)-Piperidine-3-carbonitrile oxalic acid, 95%, (3R)-piperidine-3-carbonitrile oxalic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g.
Oxalic acid;(3R)-piperidine-3-carbonitrile (CAS 2227198-66-3) is a chemical compound with the molecular formula C8H12N2O4 and a molecular weight of 200.19 g/mol. IUPAC name: oxalic acid;(3R)-piperidine-3-carbonitrile. InChIKey: HNNODRZDKBPKLS-RGMNGODLSA-N.
| Molecular formula | C8H12N2O4 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | oxalic acid;(3R)-piperidine-3-carbonitrile |
| InChIKey | HNNODRZDKBPKLS-RGMNGODLSA-N |
| SMILES | C1C[C@H](CNC1)C#N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)