CAS 21282-08-6 appears in our catalog under these names: L-Pyroglutamyl alanine, 95%, L-Pyroglutamyl-L-Alanine (Pyr-Ala-OH), L-Pyroglutamyl-L-alanine, >95% (HPLC), Pyr–Ala–OH, H-Pyr-Ala-OH, 98%, 98%. Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg, on request.
(2S)-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]propanoic acid (CAS 21282-08-6) is a chemical compound with the molecular formula C8H12N2O4 and a molecular weight of 200.19 g/mol. IUPAC name: (2S)-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]propanoic acid. InChIKey: YIJVJUARZXCJJP-WHFBIAKZSA-N.
| Molecular formula | C8H12N2O4 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | (2S)-2-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]propanoic acid |
| InChIKey | YIJVJUARZXCJJP-WHFBIAKZSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)[C@@H]1CCC(=O)N1 |
Computed by PubChem (NCBI)