Products 1428141-38-1
CAS 1428141-38-1 is the registry number for Methyl (1-acetyl-3-oxopyrazolidin-4-yl)acetate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
Methyl 2-(1-acetyl-3-oxopyrazolidin-4-yl)acetate (CAS 1428141-38-1) is a chemical compound with the molecular formula C8H12N2O4 and a molecular weight of 200.19 g/mol. IUPAC name: methyl 2-(1-acetyl-3-oxopyrazolidin-4-yl)acetate. InChIKey: JOTGJCFQVOQGEK-UHFFFAOYSA-N.
| Molecular formula | C8H12N2O4 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | methyl 2-(1-acetyl-3-oxopyrazolidin-4-yl)acetate |
| InChIKey | JOTGJCFQVOQGEK-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CC(C(=O)N1)CC(=O)OC |
Computed by PubChem (NCBI)