Products 1415719-70-8
CAS 1415719-70-8 is the registry number for 3-(6,6-Dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hex-3-yl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)benzoic acid (CAS 1415719-70-8) is a chemical compound with the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. IUPAC name: 3-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)benzoic acid. InChIKey: GZHUFBQLZMZFFG-UHFFFAOYSA-N.
| Molecular formula | C14H13NO4 |
|---|---|
| Molecular weight | 259.26 g/mol |
| IUPAC name | 3-(6,6-dimethyl-2,4-dioxo-3-azabicyclo[3.1.0]hexan-3-yl)benzoic acid |
| InChIKey | GZHUFBQLZMZFFG-UHFFFAOYSA-N |
| SMILES | CC1(C2C1C(=O)N(C2=O)C3=CC=CC(=C3)C(=O)O)C |
Computed by PubChem (NCBI)