Products 332129-63-2

CAS 332129-63-2 is the registry number for 3-[(4,5-Dimethyl-2-furoyl)amino]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-[4-[(3-methylfuran-2-carbonyl)amino]phenyl]acetic acid (CAS 332129-63-2) is a chemical compound with the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. IUPAC name: 2-[4-[(3-methylfuran-2-carbonyl)amino]phenyl]acetic acid. InChIKey: VERAUCCGLBLTGA-UHFFFAOYSA-N.

Identity
Molecular formulaC14H13NO4
Molecular weight259.26 g/mol
IUPAC name2-[4-[(3-methylfuran-2-carbonyl)amino]phenyl]acetic acid
InChIKeyVERAUCCGLBLTGA-UHFFFAOYSA-N
SMILESCC1=C(OC=C1)C(=O)NC2=CC=C(C=C2)CC(=O)O

Computed by PubChem (NCBI)