Products 926252-81-5
CAS 926252-81-5 appears in our catalog under these names: 3-Methyl-2-[(2-methylfuran-3-)amido]benzoic acid, 95%, 3-Methyl-2-(2-methylfuran-3-amido)benzoic acid, 95%, 3-Methyl-2-(2-methylfuran-3-amido)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
3-methyl-2-[(2-methylfuran-3-carbonyl)amino]benzoic acid (CAS 926252-81-5) is a chemical compound with the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. IUPAC name: 3-methyl-2-[(2-methylfuran-3-carbonyl)amino]benzoic acid. InChIKey: DGNIOTMWXFAYIO-UHFFFAOYSA-N.
| Molecular formula | C14H13NO4 |
|---|---|
| Molecular weight | 259.26 g/mol |
| IUPAC name | 3-methyl-2-[(2-methylfuran-3-carbonyl)amino]benzoic acid |
| InChIKey | DGNIOTMWXFAYIO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C(=O)O)NC(=O)C2=C(OC=C2)C |
Computed by PubChem (NCBI)