CAS 692764-08-2 is the registry number for Ethyl 6-acetyl-1,4-dihydro-4-oxoquinoline-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Ethyl 6-acetyl-4-oxo-1H-quinoline-3-carboxylate (CAS 692764-08-2) is a chemical compound with the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. IUPAC name: ethyl 6-acetyl-4-oxo-1H-quinoline-3-carboxylate. InChIKey: GMLXNCOTYSICIS-UHFFFAOYSA-N.
| Molecular formula | C14H13NO4 |
|---|---|
| Molecular weight | 259.26 g/mol |
| IUPAC name | ethyl 6-acetyl-4-oxo-1H-quinoline-3-carboxylate |
| InChIKey | GMLXNCOTYSICIS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CNC2=C(C1=O)C=C(C=C2)C(=O)C |
Computed by PubChem (NCBI)