Products 1416018-20-6
CAS 1416018-20-6 appears in our catalog under these names: Norepinephrine Impurity 48, Noradrenaline (Norepinephrine) Impurity 44. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2-aminoacetyl)cyclohexa-3,5-diene-1,2-dione (CAS 1416018-20-6) is a chemical compound with the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. IUPAC name: 4-(2-aminoacetyl)cyclohexa-3,5-diene-1,2-dione. InChIKey: NKAVPSBHKLTKRZ-UHFFFAOYSA-N.
| Molecular formula | C8H7NO3 |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | 4-(2-aminoacetyl)cyclohexa-3,5-diene-1,2-dione |
| InChIKey | NKAVPSBHKLTKRZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)C(=O)C=C1C(=O)CN |
Computed by PubChem (NCBI)