Products 1416323-13-1
CAS 1416323-13-1 appears in our catalog under these names: (7-Methoxyquinolin-3-yl)boronic acid, (7-Methoxyquinolin-3-yl)boronic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg.
(7-methoxyquinolin-3-yl)boronic acid (CAS 1416323-13-1) is a chemical compound with the molecular formula C10H10BNO3 and a molecular weight of 203.00 g/mol. IUPAC name: (7-methoxyquinolin-3-yl)boronic acid. InChIKey: GCZYMLPODXVJOC-UHFFFAOYSA-N.
| Molecular formula | C10H10BNO3 |
|---|---|
| Molecular weight | 203.00 g/mol |
| IUPAC name | (7-methoxyquinolin-3-yl)boronic acid |
| InChIKey | GCZYMLPODXVJOC-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C(C=C2)OC)N=C1)(O)O |
Computed by PubChem (NCBI)