CAS 1416344-50-7 is the registry number for Ethyl 5-(3-nitrophenyl)-1H-1,2,4-triazole-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-(3-nitrophenyl)-1H-1,2,4-triazole-5-carboxylate (CAS 1416344-50-7) is a chemical compound with the molecular formula C11H10N4O4 and a molecular weight of 262.22 g/mol. IUPAC name: ethyl 3-(3-nitrophenyl)-1H-1,2,4-triazole-5-carboxylate. InChIKey: FCGNKXHPXCVPQJ-UHFFFAOYSA-N.
| Molecular formula | C11H10N4O4 |
|---|---|
| Molecular weight | 262.22 g/mol |
| IUPAC name | ethyl 3-(3-nitrophenyl)-1H-1,2,4-triazole-5-carboxylate |
| InChIKey | FCGNKXHPXCVPQJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=NN1)C2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)