Products 406470-74-4

CAS 406470-74-4 is the registry number for 4-(3-Nitro-(1,2,4)triazol-1-ylmethyl)-benzoic acid methyl ester. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 4-[(3-nitro-1,2,4-triazol-1-yl)methyl]benzoate (CAS 406470-74-4) is a chemical compound with the molecular formula C11H10N4O4 and a molecular weight of 262.22 g/mol. IUPAC name: methyl 4-[(3-nitro-1,2,4-triazol-1-yl)methyl]benzoate. InChIKey: YFZZBOUDQHUOON-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10N4O4
Molecular weight262.22 g/mol
IUPAC namemethyl 4-[(3-nitro-1,2,4-triazol-1-yl)methyl]benzoate
InChIKeyYFZZBOUDQHUOON-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=C(C=C1)CN2C=NC(=N2)[N+](=O)[O-]

Computed by PubChem (NCBI)