Products 1416347-70-0

CAS 1416347-70-0 is the registry number for Ethyl 5-(2-nitrophenyl)-1H-1,2,4-triazole-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 3-(2-nitrophenyl)-1H-1,2,4-triazole-5-carboxylate (CAS 1416347-70-0) is a chemical compound with the molecular formula C11H10N4O4 and a molecular weight of 262.22 g/mol. IUPAC name: ethyl 3-(2-nitrophenyl)-1H-1,2,4-triazole-5-carboxylate. InChIKey: ZULSJMVGWFZXRD-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10N4O4
Molecular weight262.22 g/mol
IUPAC nameethyl 3-(2-nitrophenyl)-1H-1,2,4-triazole-5-carboxylate
InChIKeyZULSJMVGWFZXRD-UHFFFAOYSA-N
SMILESCCOC(=O)C1=NC(=NN1)C2=CC=CC=C2[N+](=O)[O-]

Computed by PubChem (NCBI)