Products 2632895-95-3

CAS 2632895-95-3 is the registry number for 4-Acetoxybenzyl alcohol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

Ethyl 2-nitro-6-(triazol-2-yl)benzoate (CAS 2632895-95-3) is a chemical compound with the molecular formula C11H10N4O4 and a molecular weight of 262.22 g/mol. IUPAC name: ethyl 2-nitro-6-(triazol-2-yl)benzoate. InChIKey: CCGTTYWAGKLEMV-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10N4O4
Molecular weight262.22 g/mol
IUPAC nameethyl 2-nitro-6-(triazol-2-yl)benzoate
InChIKeyCCGTTYWAGKLEMV-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C=CC=C1[N+](=O)[O-])N2N=CC=N2

Computed by PubChem (NCBI)