CAS 1416438-03-3 appears in our catalog under these names: 1-(3-Methylphenyl)cyclobutan-1-amine hydrochloride, 1-(3-METHYLPHENYL)CYCLOBUTAN-1-AMINE HCL, 90%, 1-m-Tolylcyclobutanamine hydrochloride, 95+%, 1–(m–tolyl)cyclobutan–1–amine hydrochloride, 1-m-Tolylcyclobutanamine hydrochloride. Offered by: Biosynth, Fluorochem, AmBeed, GLPBio, Chemat. Available pack sizes: 50mg, 0,5g, 250mg, 1g.
1-(3-methylphenyl)cyclobutan-1-amine;hydrochloride (CAS 1416438-03-3) is a chemical compound with the molecular formula C11H16ClN and a molecular weight of 197.70 g/mol. IUPAC name: 1-(3-methylphenyl)cyclobutan-1-amine;hydrochloride. InChIKey: YTLUCHQNIIQPTI-UHFFFAOYSA-N.
| Molecular formula | C11H16ClN |
|---|---|
| Molecular weight | 197.70 g/mol |
| IUPAC name | 1-(3-methylphenyl)cyclobutan-1-amine;hydrochloride |
| InChIKey | YTLUCHQNIIQPTI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2(CCC2)N.Cl |
Computed by PubChem (NCBI)