Products 1416696-44-0
CAS 1416696-44-0 appears in our catalog under these names: (4S)-2-Oxoclopidogrel, Becondogrel. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, Get quote.
Methyl (2S)-2-[(7aS)-2-oxo-4,6,7,7a-tetrahydrothieno[3,2-c]pyridin-5-yl]-2-(2-chlorophenyl)acetate (CAS 1416696-44-0) is a chemical compound with the molecular formula C16H16ClNO3S and a molecular weight of 337.8 g/mol. IUPAC name: methyl (2S)-2-[(7aS)-2-oxo-4,6,7,7a-tetrahydrothieno[3,2-c]pyridin-5-yl]-2-(2-chlorophenyl)acetate. InChIKey: JBSAZVIMJUOBNB-ZFWWWQNUSA-N.
| Molecular formula | C16H16ClNO3S |
|---|---|
| Molecular weight | 337.8 g/mol |
| IUPAC name | methyl (2S)-2-[(7aS)-2-oxo-4,6,7,7a-tetrahydrothieno[3,2-c]pyridin-5-yl]-2-(2-chlorophenyl)acetate |
| InChIKey | JBSAZVIMJUOBNB-ZFWWWQNUSA-N |
| SMILES | COC(=O)[C@H](C1=CC=CC=C1Cl)N2CC[C@H]3C(=CC(=O)S3)C2 |
Computed by PubChem (NCBI)