CAS 527687-26-9 is the registry number for Clopidogrel Impurity 53. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2S)-2-(2-chlorophenyl)-2-(2-oxo-3,4,6,7-tetrahydrothieno[3,2-c]pyridin-5-yl)acetate (CAS 527687-26-9) is a chemical compound with the molecular formula C16H16ClNO3S and a molecular weight of 337.8 g/mol. IUPAC name: methyl (2S)-2-(2-chlorophenyl)-2-(2-oxo-3,4,6,7-tetrahydrothieno[3,2-c]pyridin-5-yl)acetate. InChIKey: AZRUDPJZBRJPHU-HNNXBMFYSA-N.
| Molecular formula | C16H16ClNO3S |
|---|---|
| Molecular weight | 337.8 g/mol |
| IUPAC name | methyl (2S)-2-(2-chlorophenyl)-2-(2-oxo-3,4,6,7-tetrahydrothieno[3,2-c]pyridin-5-yl)acetate |
| InChIKey | AZRUDPJZBRJPHU-HNNXBMFYSA-N |
| SMILES | COC(=O)[C@H](C1=CC=CC=C1Cl)N2CCC3=C(C2)CC(=O)S3 |
Computed by PubChem (NCBI)