CAS 1416713-78-4 is the registry number for Methyl 1-chlorophthalazine-6-carboxylate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 1-chlorophthalazine-6-carboxylate (CAS 1416713-78-4) is a chemical compound with the molecular formula C10H7ClN2O2 and a molecular weight of 222.63 g/mol. IUPAC name: methyl 1-chlorophthalazine-6-carboxylate. InChIKey: DYTFPIINWVHHSA-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O2 |
|---|---|
| Molecular weight | 222.63 g/mol |
| IUPAC name | methyl 1-chlorophthalazine-6-carboxylate |
| InChIKey | DYTFPIINWVHHSA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=CN=NC(=C2C=C1)Cl |
Computed by PubChem (NCBI)