CAS 141691-41-0 appears in our catalog under these names: 2-Amino-1-methyl-1H-1,3-benzodiazole-5-carbonitrile, 95%, 2-Amino-1-methyl-1H-1,3-benzodiazole-5-carbonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-amino-1-methylbenzimidazole-5-carbonitrile (CAS 141691-41-0) is a chemical compound with the molecular formula C9H8N4 and a molecular weight of 172.19 g/mol. IUPAC name: 2-amino-1-methylbenzimidazole-5-carbonitrile. InChIKey: VWOBVMUYALAJKO-UHFFFAOYSA-N.
| Molecular formula | C9H8N4 |
|---|---|
| Molecular weight | 172.19 g/mol |
| IUPAC name | 2-amino-1-methylbenzimidazole-5-carbonitrile |
| InChIKey | VWOBVMUYALAJKO-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)C#N)N=C1N |
Computed by PubChem (NCBI)