Products 1417357-06-2
CAS 1417357-06-2 is the registry number for 3-[(2-Amino-5-benzoylphenyl)amino]cyclohex-2-en-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(2-amino-5-benzoylanilino)cyclohex-2-en-1-one (CAS 1417357-06-2) is a chemical compound with the molecular formula C19H18N2O2 and a molecular weight of 306.4 g/mol. IUPAC name: 3-(2-amino-5-benzoylanilino)cyclohex-2-en-1-one. InChIKey: FAUBNUSWQABNEC-UHFFFAOYSA-N.
| Molecular formula | C19H18N2O2 |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | 3-(2-amino-5-benzoylanilino)cyclohex-2-en-1-one |
| InChIKey | FAUBNUSWQABNEC-UHFFFAOYSA-N |
| SMILES | C1CC(=CC(=O)C1)NC2=C(C=CC(=C2)C(=O)C3=CC=CC=C3)N |
Computed by PubChem (NCBI)