Products 956624-58-1

CAS 956624-58-1 is the registry number for 3-(4-Ethylphenyl)-1-(2-methylphenyl)-1h-pyrazole-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

3-(4-ethylphenyl)-1-(2-methylphenyl)pyrazole-4-carboxylic acid (CAS 956624-58-1) is a chemical compound with the molecular formula C19H18N2O2 and a molecular weight of 306.4 g/mol. IUPAC name: 3-(4-ethylphenyl)-1-(2-methylphenyl)pyrazole-4-carboxylic acid. InChIKey: GSVUCMSCGKUEBU-UHFFFAOYSA-N.

Identity
Molecular formulaC19H18N2O2
Molecular weight306.4 g/mol
IUPAC name3-(4-ethylphenyl)-1-(2-methylphenyl)pyrazole-4-carboxylic acid
InChIKeyGSVUCMSCGKUEBU-UHFFFAOYSA-N
SMILESCCC1=CC=C(C=C1)C2=NN(C=C2C(=O)O)C3=CC=CC=C3C

Computed by PubChem (NCBI)