Products 116574-14-2

CAS 116574-14-2 is the registry number for 1-Benzhydrylazetidin-3-yl 2-cyanoacetate, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

(1-benzhydrylazetidin-3-yl) 2-cyanoacetate (CAS 116574-14-2) is a chemical compound with the molecular formula C19H18N2O2 and a molecular weight of 306.4 g/mol. IUPAC name: (1-benzhydrylazetidin-3-yl) 2-cyanoacetate. InChIKey: KSZGPBFUBSHVTO-UHFFFAOYSA-N.

Identity
Molecular formulaC19H18N2O2
Molecular weight306.4 g/mol
IUPAC name(1-benzhydrylazetidin-3-yl) 2-cyanoacetate
InChIKeyKSZGPBFUBSHVTO-UHFFFAOYSA-N
SMILESC1C(CN1C(C2=CC=CC=C2)C3=CC=CC=C3)OC(=O)CC#N

Computed by PubChem (NCBI)