CAS 101657-77-6 is the registry number for 4,4'-Methylenebis(2,6-dimethylphenylcyanate), 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[4-[(4-cyanato-3,5-dimethylphenyl)methyl]-2,6-dimethylphenyl] cyanate (CAS 101657-77-6) is a chemical compound with the molecular formula C19H18N2O2 and a molecular weight of 306.4 g/mol. IUPAC name: [4-[(4-cyanato-3,5-dimethylphenyl)methyl]-2,6-dimethylphenyl] cyanate. InChIKey: JNCRKOQSRHDNIO-UHFFFAOYSA-N.
| Molecular formula | C19H18N2O2 |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | [4-[(4-cyanato-3,5-dimethylphenyl)methyl]-2,6-dimethylphenyl] cyanate |
| InChIKey | JNCRKOQSRHDNIO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1OC#N)C)CC2=CC(=C(C(=C2)C)OC#N)C |
Computed by PubChem (NCBI)