Products 1417737-65-5
CAS 1417737-65-5 is the registry number for Metallo-β-lactamase-IN-5. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[benzyl-[(8-hydroxy-5-nitroquinolin-7-yl)methyl]amino]acetonitrile (CAS 1417737-65-5) is a chemical compound with the molecular formula C19H16N4O3 and a molecular weight of 348.4 g/mol. IUPAC name: 2-[benzyl-[(8-hydroxy-5-nitroquinolin-7-yl)methyl]amino]acetonitrile. InChIKey: CJFJGNGFFLNDIH-UHFFFAOYSA-N.
| Molecular formula | C19H16N4O3 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | 2-[benzyl-[(8-hydroxy-5-nitroquinolin-7-yl)methyl]amino]acetonitrile |
| InChIKey | CJFJGNGFFLNDIH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN(CC#N)CC2=CC(=C3C=CC=NC3=C2O)[N+](=O)[O-] |
Computed by PubChem (NCBI)