Products 61369-43-5
CAS 61369-43-5 appears in our catalog under these names: NSC 288387, 98.08%, NSC 288387, 96%, 10-(2-Methoxyethyl)-3-phenylbenzo[g]pteridine-2,4(3H,10H)-dione, 96%. Offered by: MedChemExpress, Ambeed, BLDpharm. Available pack sizes: 25 mg, 10 mg, 5 mg, 50 mg, 100 mg, 1mg, 5mg, 10mg.
10-(2-methoxyethyl)-3-phenylbenzo[g]pteridine-2,4-dione (CAS 61369-43-5) is a chemical compound with the molecular formula C19H16N4O3 and a molecular weight of 348.4 g/mol. IUPAC name: 10-(2-methoxyethyl)-3-phenylbenzo[g]pteridine-2,4-dione. InChIKey: VBIVGEJXWFOZBG-UHFFFAOYSA-N.
| Molecular formula | C19H16N4O3 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | 10-(2-methoxyethyl)-3-phenylbenzo[g]pteridine-2,4-dione |
| InChIKey | VBIVGEJXWFOZBG-UHFFFAOYSA-N |
| SMILES | COCCN1C2=CC=CC=C2N=C3C1=NC(=O)N(C3=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)