Products 1417825-76-3
CAS 1417825-76-3 is the registry number for 5-[2-(4-HYDROXYPHENYL)DIAZENYL]-1,3-BENZENEDICARBOXYLIC ACID, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-[(4-hydroxyphenyl)diazenyl]benzene-1,3-dicarboxylic acid (CAS 1417825-76-3) is a chemical compound with the molecular formula C14H10N2O5 and a molecular weight of 286.24 g/mol. IUPAC name: 5-[(4-hydroxyphenyl)diazenyl]benzene-1,3-dicarboxylic acid. InChIKey: SIDSWTSASPIKMQ-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O5 |
|---|---|
| Molecular weight | 286.24 g/mol |
| IUPAC name | 5-[(4-hydroxyphenyl)diazenyl]benzene-1,3-dicarboxylic acid |
| InChIKey | SIDSWTSASPIKMQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=NC2=CC(=CC(=C2)C(=O)O)C(=O)O)O |
Computed by PubChem (NCBI)